C20H20N2O3 — CID 102466386
(1S,6R)-2,4,6-trimethyl-7,7-diphenyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione (PubChem CID 102466386) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1S,6R)-2,4,6-trimethyl-7,7-diphenyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | (1S,6R)-2,4,6-trimethyl-7,7-diphenyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 102466386 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1S,6R)-2,4,6-trimethyl-7,7-diphenyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
| SMILES | CN1C(=O)N(C)[C@H]2OC(c3ccccc3)(c3ccccc3)[C@@]2(C)C1=O |
| InChI | InChI=1S/C20H20N2O3/c1-19-16(23)21(2)18(24)22(3)17(19)25-20(19,14-10-6-4-7-11-14)15-12-8-5-9-13-15/h4-13,17H,1-3H3/t17-,19-/m0/s1 |
| InChIKey | RZBKOAXPKCMKNK-HKUYNNGSSA-N |
| XLogP | 2.82 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |