C14H20N2O2 — CID 90723547
ethane;3,5,5-trimethyl-1-phenylimidazolidine-2,4-dione (PubChem CID 90723547) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is ethane;3,5,5-trimethyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | ethane;3,5,5-trimethyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90723547 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | ethane;3,5,5-trimethyl-1-phenylimidazolidine-2,4-dione |
| SMILES | CC.CN1C(=O)N(c2ccccc2)C(C)(C)C1=O |
| InChI | InChI=1S/C12H14N2O2.C2H6/c1-12(2)10(15)13(3)11(16)14(12)9-7-5-4-6-8-9;1-2/h4-8H,1-3H3;1-2H3 |
| InChIKey | NZNQVICSLSXILE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|