C18H16N2O4 — CID 161316865
1-methoxy-3-methyl-5,5-diphenyl-1,3-diazinane-2,4,6-trione (PubChem CID 161316865) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-methoxy-3-methyl-5,5-diphenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-methoxy-3-methyl-5,5-diphenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 161316865 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-methoxy-3-methyl-5,5-diphenyl-1,3-diazinane-2,4,6-trione |
| SMILES | CON1C(=O)N(C)C(=O)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H16N2O4/c1-19-15(21)18(13-9-5-3-6-10-13,14-11-7-4-8-12-14)16(22)20(24-2)17(19)23/h3-12H,1-2H3 |
| InChIKey | VJPNMXADPWMGNX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|