C21H17NO2 — CID 156782915
1-methoxy-3,3-diphenylindol-2-one (PubChem CID 156782915) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 1-methoxy-3,3-diphenylindol-2-one.
| Compound Name | 1-methoxy-3,3-diphenylindol-2-one |
|---|---|
| PubChem CID | 156782915 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-methoxy-3,3-diphenylindol-2-one |
| SMILES | CON1C(=O)C(c2ccccc2)(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H17NO2/c1-24-22-19-15-9-8-14-18(19)21(20(22)23,16-10-4-2-5-11-16)17-12-6-3-7-13-17/h2-15H,1H3 |
| InChIKey | IFURGPVCZUYLMJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |