C21H19N3O4 — CID 10785812
2-[2-[(4R)-1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethyl]isoindole-1,3-dione (PubChem CID 10785812) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-[2-[(4R)-1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4R)-1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10785812 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[2-[(4R)-1,3-dimethyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethyl]isoindole-1,3-dione |
| SMILES | CN1C(=O)N(C)[C@](CCN2C(=O)c3ccccc3C2=O)(c2ccccc2)C1=O |
| InChI | InChI=1S/C21H19N3O4/c1-22-19(27)21(23(2)20(22)28,14-8-4-3-5-9-14)12-13-24-17(25)15-10-6-7-11-16(15)18(24)26/h3-11H,12-13H2,1-2H3/t21-/m1/s1 |
| InChIKey | BVLNQAROEDXSJX-OAQYLSRUSA-N |
| XLogP | 2.09 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|