C16H19NO3 — CID 122459425
2-[2-(2,3-diethyloxiran-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 122459425) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-[2-(2,3-diethyloxiran-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2,3-diethyloxiran-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 122459425 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[2-(2,3-diethyloxiran-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | CCC1OC1(CC)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H19NO3/c1-3-13-16(4-2,20-13)9-10-17-14(18)11-7-5-6-8-12(11)15(17)19/h5-8,13H,3-4,9-10H2,1-2H3 |
| InChIKey | LZMBXAQHFACWDC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|