C11H12N3O2- — CID 22960631
(1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl)methylazanide (PubChem CID 22960631) has the molecular formula C11H12N3O2- and a molecular weight of 218.24 g/mol. Its IUPAC name is (1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl)methylazanide.
| Compound Name | (1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl)methylazanide |
|---|---|
| PubChem CID | 22960631 |
| Molecular Formula | C11H12N3O2- |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl)methylazanide |
| SMILES | CN1C(=O)NC(C[NH-])(c2ccccc2)C1=O |
| InChI | InChI=1S/C11H12N3O2/c1-14-9(15)11(7-12,13-10(14)16)8-5-3-2-4-6-8/h2-6,12H,7H2,1H3,(H,13,16)/q-1 |
| InChIKey | GJLLCSLUWSWRGR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|