C12H16ClN3O2 — CID 10612066
2-[(4R)-1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethylazanium chloride (PubChem CID 10612066) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 2-[(4R)-1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethylazanium chloride.
| Compound Name | 2-[(4R)-1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethylazanium chloride |
|---|---|
| PubChem CID | 10612066 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-[(4R)-1-methyl-2,5-dioxo-4-phenylimidazolidin-4-yl]ethylazanium chloride |
| SMILES | CN1C(=O)N[C@](CC[NH3+])(c2ccccc2)C1=O.[Cl-] |
| InChI | InChI=1S/C12H15N3O2.ClH/c1-15-10(16)12(7-8-13,14-11(15)17)9-5-3-2-4-6-9;/h2-6H,7-8,13H2,1H3,(H,14,17);1H/t12-;/m1./s1 |
| InChIKey | WBUZLFJXPYPMOM-UTONKHPSSA-N |
| XLogP | -3.30 |
| TPSA | 77.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|