C19H22N4O4 — CID 17403045
6-[(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 17403045) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 6-[(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 17403045 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-[(2,5-dioxo-4-phenyl-4-propylimidazolidin-1-yl)methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CCCC1(c2ccccc2)NC(=O)N(Cc2cc(=O)n(C)c(=O)n2C)C1=O |
| InChI | InChI=1S/C19H22N4O4/c1-4-10-19(13-8-6-5-7-9-13)16(25)23(17(26)20-19)12-14-11-15(24)22(3)18(27)21(14)2/h5-9,11H,4,10,12H2,1-3H3,(H,20,26) |
| InChIKey | DQGBWXCFOWMLAT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|