C19H30N2O4 — CID 90917596
benzene;2,6-dimethyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;ethane (PubChem CID 90917596) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is benzene;2,6-dimethyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;ethane.
| Compound Name | benzene;2,6-dimethyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;ethane |
|---|---|
| PubChem CID | 90917596 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | benzene;2,6-dimethyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;ethane |
| SMILES | CC.CC.CC.CN1C(=O)C2(C1=O)C(=O)N(C)C2=O.c1ccccc1 |
| InChI | InChI=1S/C7H6N2O4.C6H6.3C2H6/c1-8-3(10)7(4(8)11)5(12)9(2)6(7)13;1-2-4-6-5-3-1;3*1-2/h1-2H3;1-6H;3*1-2H3 |
| InChIKey | ROPZLMAFCBMMQS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|