C7H6N2O4Y2-2 — CID 59444906
carbanide;2-methyl-2-aza-6-azanidaspiro[3.3]heptane-1,3,5,7-tetrone;bis(yttrium) (PubChem CID 59444906) has the molecular formula C7H6N2O4Y2-2 and a molecular weight of 359.95 g/mol. Its IUPAC name is carbanide;2-methyl-2-aza-6-azanidaspiro[3.3]heptane-1,3,5,7-tetrone;bis(yttrium).
| Compound Name | carbanide;2-methyl-2-aza-6-azanidaspiro[3.3]heptane-1,3,5,7-tetrone;bis(yttrium) |
|---|---|
| PubChem CID | 59444906 |
| Molecular Formula | C7H6N2O4Y2-2 |
| Molecular Weight | 359.95 g/mol |
| Exact Mass | 359.85 |
| IUPAC Name | carbanide;2-methyl-2-aza-6-azanidaspiro[3.3]heptane-1,3,5,7-tetrone;bis(yttrium) |
| SMILES | CN1C(=O)C2(C(=O)[N-]C2=O)C1=O.[CH3-].[Y].[Y] |
| InChI | InChI=1S/C6H4N2O4.CH3.2Y/c1-8-4(11)6(5(8)12)2(9)7-3(6)10;;;/h1H3,(H,7,9,10);1H3;;/q;-1;;/p-1 |
| InChIKey | MPZLVEQSIJSTSO-UHFFFAOYSA-M |
| XLogP | -1.14 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.95 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|