C12H16N2O — CID 121015533
1,3,3,4-tetramethylquinoxalin-2-one (PubChem CID 121015533) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,3,3,4-tetramethylquinoxalin-2-one.
| Compound Name | 1,3,3,4-tetramethylquinoxalin-2-one |
|---|---|
| PubChem CID | 121015533 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1,3,3,4-tetramethylquinoxalin-2-one |
| SMILES | CN1C(=O)C(C)(C)N(C)c2ccccc21 |
| InChI | InChI=1S/C12H16N2O/c1-12(2)11(15)13(3)9-7-5-6-8-10(9)14(12)4/h5-8H,1-4H3 |
| InChIKey | FMIVVPUTJVDVMS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |