C12H15ClN2O2 — CID 172764776
3,3,5-trimethyl-1H-1,5-benzodiazepine-2,4-dione;hydrochloride (PubChem CID 172764776) has the molecular formula C12H15ClN2O2 and a molecular weight of 254.72 g/mol. Its IUPAC name is 3,3,5-trimethyl-1H-1,5-benzodiazepine-2,4-dione;hydrochloride.
| Compound Name | 3,3,5-trimethyl-1H-1,5-benzodiazepine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 172764776 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3,3,5-trimethyl-1H-1,5-benzodiazepine-2,4-dione;hydrochloride |
| SMILES | CN1C(=O)C(C)(C)C(=O)Nc2ccccc21.Cl |
| InChI | InChI=1S/C12H14N2O2.ClH/c1-12(2)10(15)13-8-6-4-5-7-9(8)14(3)11(12)16;/h4-7H,1-3H3,(H,13,15);1H |
| InChIKey | MDXCWAOJLGEFJW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|