C15H18N2O — CID 162417249
(1R,12R)-11,11-dimethyl-3,10-diazatetracyclo[8.5.0.01,12.04,9]pentadeca-4,6,8-trien-2-one (PubChem CID 162417249) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is (1R,12R)-11,11-dimethyl-3,10-diazatetracyclo[8.5.0.01,12.04,9]pentadeca-4,6,8-trien-2-one.
| Compound Name | (1R,12R)-11,11-dimethyl-3,10-diazatetracyclo[8.5.0.01,12.04,9]pentadeca-4,6,8-trien-2-one |
|---|---|
| PubChem CID | 162417249 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (1R,12R)-11,11-dimethyl-3,10-diazatetracyclo[8.5.0.01,12.04,9]pentadeca-4,6,8-trien-2-one |
| SMILES | CC1(C)[C@H]2CCC[C@]23C(=O)Nc2ccccc2N13 |
| InChI | InChI=1S/C15H18N2O/c1-14(2)12-8-5-9-15(12)13(18)16-10-6-3-4-7-11(10)17(14)15/h3-4,6-7,12H,5,8-9H2,1-2H3,(H,16,18)/t12-,15-/m1/s1 |
| InChIKey | UBKCQLGWYVQAEK-IUODEOHRSA-N |
| XLogP | 2.78 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |