C17H23N3O — CID 102893113
1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone (PubChem CID 102893113) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone.
| Compound Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone |
|---|---|
| PubChem CID | 102893113 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl-(4-methyl-2,3-dihydroquinoxalin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)C2NCC3CCCC32)c2ccccc21 |
| InChI | InChI=1S/C17H23N3O/c1-19-9-10-20(15-8-3-2-7-14(15)19)17(21)16-13-6-4-5-12(13)11-18-16/h2-3,7-8,12-13,16,18H,4-6,9-11H2,1H3 |
| InChIKey | NMRPWPHHZYNOFX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |