C10H12N2O — CID 21300254
1,3,3-trimethylpyrrolo[3,2-c]pyridin-2-one (PubChem CID 21300254) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 1,3,3-trimethylpyrrolo[3,2-c]pyridin-2-one.
| Compound Name | 1,3,3-trimethylpyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 21300254 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 1,3,3-trimethylpyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)C(C)(C)c2cnccc21 |
| InChI | InChI=1S/C10H12N2O/c1-10(2)7-6-11-5-4-8(7)12(3)9(10)13/h4-6H,1-3H3 |
| InChIKey | UAJUPEWLBDXBBI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |