C7H11N3O5 — CID 7333015
(5S,6S)-6-hydroxy-1,3,5-trimethyl-5-nitro-1,3-diazinane-2,4-dione (PubChem CID 7333015) has the molecular formula C7H11N3O5 and a molecular weight of 217.18 g/mol. Its IUPAC name is (5S,6S)-6-hydroxy-1,3,5-trimethyl-5-nitro-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6S)-6-hydroxy-1,3,5-trimethyl-5-nitro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 7333015 |
| Molecular Formula | C7H11N3O5 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | (5S,6S)-6-hydroxy-1,3,5-trimethyl-5-nitro-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)N(C)[C@@H](O)[C@](C)([N+](=O)[O-])C1=O |
| InChI | InChI=1S/C7H11N3O5/c1-7(10(14)15)4(11)8(2)6(13)9(3)5(7)12/h4,11H,1-3H3/t4-,7-/m0/s1 |
| InChIKey | MJNNTSDEJJTOIW-FFWSUHOLSA-N |
| XLogP | -1.14 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|