C11H18N2O3 — CID 134859786
1,3-dimethyl-3-(nitromethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one (PubChem CID 134859786) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1,3-dimethyl-3-(nitromethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one.
| Compound Name | 1,3-dimethyl-3-(nitromethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one |
|---|---|
| PubChem CID | 134859786 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1,3-dimethyl-3-(nitromethyl)-3a,4,5,6,7,7a-hexahydroindol-2-one |
| SMILES | CN1C(=O)C(C)(C[N+](=O)[O-])C2CCCCC21 |
| InChI | InChI=1S/C11H18N2O3/c1-11(7-13(15)16)8-5-3-4-6-9(8)12(2)10(11)14/h8-9H,3-7H2,1-2H3 |
| InChIKey | MHIKUVCQYFYEFH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|