C8H13NO4 — CID 131591888
trans-(2S,3R)-3-hydroxy-2-methyl-2-(2-nitroethyl)cyclopentan-1-one (PubChem CID 131591888) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is trans-(2S,3R)-3-hydroxy-2-methyl-2-(2-nitroethyl)cyclopentan-1-one.
| Compound Name | trans-(2S,3R)-3-hydroxy-2-methyl-2-(2-nitroethyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 131591888 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | trans-(2S,3R)-3-hydroxy-2-methyl-2-(2-nitroethyl)cyclopentan-1-one |
| SMILES | C[C@@]1(CC[N+](=O)[O-])C(=O)CC[C@H]1O |
| InChI | InChI=1S/C8H13NO4/c1-8(4-5-9(12)13)6(10)2-3-7(8)11/h6,10H,2-5H2,1H3/t6-,8+/m1/s1 |
| InChIKey | HQSSEMYFNRIRIK-SVRRBLITSA-N |
| XLogP | 0.38 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|