C12H18O — CID 10035179
trans-(2S,3R)-2-but-3-ynyl-2,3-dimethylcyclohexan-1-one (PubChem CID 10035179) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is trans-(2S,3R)-2-but-3-ynyl-2,3-dimethylcyclohexan-1-one.
| Compound Name | trans-(2S,3R)-2-but-3-ynyl-2,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 10035179 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | trans-(2S,3R)-2-but-3-ynyl-2,3-dimethylcyclohexan-1-one |
| SMILES | C#CCC[C@]1(C)C(=O)CCC[C@H]1C |
| InChI | InChI=1S/C12H18O/c1-4-5-9-12(3)10(2)7-6-8-11(12)13/h1,10H,5-9H2,2-3H3/t10-,12+/m1/s1 |
| InChIKey | UWZLYKHIYMCERT-PWSUYJOCSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|