C10H14N2O2 — CID 64972576
1-but-3-ynyl-3-methyl-1,4-diazepane-2,5-dione (PubChem CID 64972576) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1-but-3-ynyl-3-methyl-1,4-diazepane-2,5-dione.
| Compound Name | 1-but-3-ynyl-3-methyl-1,4-diazepane-2,5-dione |
|---|---|
| PubChem CID | 64972576 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 1-but-3-ynyl-3-methyl-1,4-diazepane-2,5-dione |
| SMILES | C#CCCN1CCC(=O)NC(C)C1=O |
| InChI | InChI=1S/C10H14N2O2/c1-3-4-6-12-7-5-9(13)11-8(2)10(12)14/h1,8H,4-7H2,2H3,(H,11,13) |
| InChIKey | IGOLAFZKMAIZDB-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|