C12H18N2O2 — CID 64972451
3-butan-2-yl-1-but-3-ynylpiperazine-2,5-dione (PubChem CID 64972451) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-butan-2-yl-1-but-3-ynylpiperazine-2,5-dione.
| Compound Name | 3-butan-2-yl-1-but-3-ynylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64972451 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 3-butan-2-yl-1-but-3-ynylpiperazine-2,5-dione |
| SMILES | C#CCCN1CC(=O)NC(C(C)CC)C1=O |
| InChI | InChI=1S/C12H18N2O2/c1-4-6-7-14-8-10(15)13-11(12(14)16)9(3)5-2/h1,9,11H,5-8H2,2-3H3,(H,13,15) |
| InChIKey | IYGYVTLGALUCAM-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|