C8H12O5 — CID 130146422
(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate (PubChem CID 130146422) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate.
| Compound Name | (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate |
|---|---|
| PubChem CID | 130146422 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate |
| SMILES | CC(=O)OCC1(O)C(=O)CCC1O |
| InChI | InChI=1S/C8H12O5/c1-5(9)13-4-8(12)6(10)2-3-7(8)11/h6,10,12H,2-4H2,1H3 |
| InChIKey | VSEHLHKIWXAGIP-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |