(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate

C8H12O5 — CID 130146422

IUPAC(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate
SMILESCC(=O)OCC1(O)C(=O)CCC1O
InChIInChI=1S/C8H12O5/c1-5(9)13-4-8(12)6(10)2-3-7(8)11/h6,10,12H,2-4H2,1H3
InChIKeyVSEHLHKIWXAGIP-UHFFFAOYSA-N
MW188.18 g/mol
LogP-1.00
Rot. Bonds2

About (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate

(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate (PubChem CID 130146422) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate.

Molecular Properties

Compound Name(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate
PubChem CID130146422
Molecular FormulaC8H12O5
Molecular Weight188.18 g/mol
Exact Mass188.07
IUPAC Name(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate
SMILESCC(=O)OCC1(O)C(=O)CCC1O
InChIInChI=1S/C8H12O5/c1-5(9)13-4-8(12)6(10)2-3-7(8)11/h6,10,12H,2-4H2,1H3
InChIKeyVSEHLHKIWXAGIP-UHFFFAOYSA-N
XLogP-1.00
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.18
LogP ≤ 5-1.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate?
The IUPAC name of (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate (CID 130146422) is (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate.
What is the SMILES notation for (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate?
The canonical SMILES for (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate is CC(=O)OCC1(O)C(=O)CCC1O.
What is the InChIKey of (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate?
The InChIKey is VSEHLHKIWXAGIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-5(9)13-4-8(12)6(10)2-3-7(8)11/h6,10,12H,2-4H2,1H3.
What are the key properties of (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate?
(1,2-dihydroxy-5-oxocyclopentyl)methyl acetate has a molecular weight of 188.18 g/mol, XLogP of -1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2-dihydroxy-5-oxocyclopentyl)methyl acetate is sourced from PubChem (CID 130146422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).