About [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate
[(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate (PubChem CID 10397526) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate.
Analyze [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate?
The IUPAC name of [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate (CID 10397526) is [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate.
What is the SMILES notation for [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate?
The canonical SMILES for [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate is CC(=O)OC[C@@]1(O)C(=O)C=C[C@H]1O.
What is the InChIKey of [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate?
The InChIKey is DVJGIZJCFYOLFM-SVRRBLITSA-N. The full InChI is InChI=1S/C8H10O5/c1-5(9)13-4-8(12)6(10)2-3-7(8)11/h2-3,6,10,12H,4H2,1H3/t6-,8+/m1/s1.
What are the key properties of [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate?
[(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate has a molecular weight of 186.16 g/mol, XLogP of -1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-1,2-dihydroxy-5-oxocyclopent-3-en-1-yl]methyl acetate is sourced from PubChem (CID 10397526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).