C10H18O4 — CID 156768140
(1,3-dihydroxy-2,2-dimethylcyclopentyl)methyl acetate (PubChem CID 156768140) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1,3-dihydroxy-2,2-dimethylcyclopentyl)methyl acetate.
| Compound Name | (1,3-dihydroxy-2,2-dimethylcyclopentyl)methyl acetate |
|---|---|
| PubChem CID | 156768140 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (1,3-dihydroxy-2,2-dimethylcyclopentyl)methyl acetate |
| SMILES | CC(=O)OCC1(O)CCC(O)C1(C)C |
| InChI | InChI=1S/C10H18O4/c1-7(11)14-6-10(13)5-4-8(12)9(10,2)3/h8,12-13H,4-6H2,1-3H3 |
| InChIKey | MIDWVCUYIRKXLW-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |