C15H26O7 — CID 101354324
[(1R,2R,6S)-2-(acetyloxymethyl)-2-hydroxy-6-(methoxymethoxy)-1-methylcyclohexyl]methyl acetate (PubChem CID 101354324) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(1R,2R,6S)-2-(acetyloxymethyl)-2-hydroxy-6-(methoxymethoxy)-1-methylcyclohexyl]methyl acetate.
| Compound Name | [(1R,2R,6S)-2-(acetyloxymethyl)-2-hydroxy-6-(methoxymethoxy)-1-methylcyclohexyl]methyl acetate |
|---|---|
| PubChem CID | 101354324 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [(1R,2R,6S)-2-(acetyloxymethyl)-2-hydroxy-6-(methoxymethoxy)-1-methylcyclohexyl]methyl acetate |
| SMILES | COCO[C@H]1CCC[C@](O)(COC(C)=O)[C@]1(C)COC(C)=O |
| InChI | InChI=1S/C15H26O7/c1-11(16)20-8-14(3)13(22-10-19-4)6-5-7-15(14,18)9-21-12(2)17/h13,18H,5-10H2,1-4H3/t13-,14+,15-/m0/s1 |
| InChIKey | MFWKBAOOSVGRFN-ZNMIVQPWSA-N |
| XLogP | 1.02 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|