C10H17NO5 — CID 11345257
cis-methyl (1R,2R)-1-acetamido-2-(methoxymethoxy)cyclobutane-1-carboxylate (PubChem CID 11345257) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is cis-methyl (1R,2R)-1-acetamido-2-(methoxymethoxy)cyclobutane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-1-acetamido-2-(methoxymethoxy)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 11345257 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | cis-methyl (1R,2R)-1-acetamido-2-(methoxymethoxy)cyclobutane-1-carboxylate |
| SMILES | COCO[C@@H]1CC[C@]1(NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C10H17NO5/c1-7(12)11-10(9(13)15-3)5-4-8(10)16-6-14-2/h8H,4-6H2,1-3H3,(H,11,12)/t8-,10-/m1/s1 |
| InChIKey | JAXCLDAYQHDSDX-PSASIEDQSA-N |
| XLogP | -0.18 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|