C8H12FNO3 — CID 59557463
methyl 1-acetamido-3-(18F)fluorocyclobutane-1-carboxylate (PubChem CID 59557463) has the molecular formula C8H12FNO3 and a molecular weight of 188.19 g/mol. Its IUPAC name is methyl 1-acetamido-3-(18F)fluorocyclobutane-1-carboxylate.
| Compound Name | methyl 1-acetamido-3-(18F)fluorocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 59557463 |
| Molecular Formula | C8H12FNO3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | methyl 1-acetamido-3-(18F)fluorocyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(NC(C)=O)CC([18F])C1 |
| InChI | InChI=1S/C8H12FNO3/c1-5(11)10-8(7(12)13-2)3-6(9)4-8/h6H,3-4H2,1-2H3,(H,10,11)/i9-1 |
| InChIKey | HCXLQMGUHNEZIT-RVRFMXCPSA-N |
| XLogP | 0.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |