C16H25NO8 — CID 10618437
cis-trimethyl (1S,2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1,2,4-tricarboxylate (PubChem CID 10618437) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is cis-trimethyl (1S,2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1,2,4-tricarboxylate.
| Compound Name | cis-trimethyl (1S,2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 10618437 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | cis-trimethyl (1S,2R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1,2,4-tricarboxylate |
| SMILES | COC(=O)[C@H]1CC(NC(=O)OC(C)(C)C)(C(=O)OC)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C16H25NO8/c1-15(2,3)25-14(21)17-16(13(20)24-6)7-9(11(18)22-4)10(8-16)12(19)23-5/h9-10H,7-8H2,1-6H3,(H,17,21)/t9-,10+,16? |
| InChIKey | NPUGLSQNLODJQV-BDTYORIJSA-N |
| XLogP | 0.80 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|