C26H44N4O12-2 — CID 126961471
bis(methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalate (PubChem CID 126961471) has the molecular formula C26H44N4O12-2 and a molecular weight of 604.65 g/mol. Its IUPAC name is bis(methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalate.
| Compound Name | bis(methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalate |
|---|---|
| PubChem CID | 126961471 |
| Molecular Formula | C26H44N4O12-2 |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | bis(methyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylate);oxalate |
| SMILES | COC(=O)C1(NC(=O)OC(C)(C)C)CCNCC1.COC(=O)C1(NC(=O)OC(C)(C)C)CCNCC1.O=C([O-])C(=O)[O-] |
| InChI | InChI=1S/2C12H22N2O4.C2H2O4/c2*1-11(2,3)18-10(16)14-12(9(15)17-4)5-7-13-8-6-12;3-1(4)2(5)6/h2*13H,5-8H2,1-4H3,(H,14,16);(H,3,4)(H,5,6)/p-2 |
| InChIKey | GMQWYNXNWCXKQY-UHFFFAOYSA-L |
| XLogP | -1.90 |
| TPSA | 233.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|