C14H23NO4 — CID 129452599
methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.4]heptane-2-carboxylate (PubChem CID 129452599) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.4]heptane-2-carboxylate.
| Compound Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.4]heptane-2-carboxylate |
|---|---|
| PubChem CID | 129452599 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | methyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]spiro[2.4]heptane-2-carboxylate |
| SMILES | COC(=O)[C@]1(NC(=O)OC(C)(C)C)CC12CCCC2 |
| InChI | InChI=1S/C14H23NO4/c1-12(2,3)19-11(17)15-14(10(16)18-4)9-13(14)7-5-6-8-13/h5-9H2,1-4H3,(H,15,17)/t14-/m1/s1 |
| InChIKey | ZWDLPUJAAXEEFR-CQSZACIVSA-N |
| XLogP | 2.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |