C12H23NO2 — CID 118317015
tert-butyl N-(1,2-dimethylcyclopentyl)carbamate (PubChem CID 118317015) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is tert-butyl N-(1,2-dimethylcyclopentyl)carbamate.
| Compound Name | tert-butyl N-(1,2-dimethylcyclopentyl)carbamate |
|---|---|
| PubChem CID | 118317015 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | tert-butyl N-(1,2-dimethylcyclopentyl)carbamate |
| SMILES | CC1CCCC1(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9-7-6-8-12(9,5)13-10(14)15-11(2,3)4/h9H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | BRSLFWLPBNVHJT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |