C32H40N2O8 — CID 100949582
dimethyl 7,15-bis[(2-methylpropan-2-yl)oxycarbonylamino]tetracyclo[7.7.2.05,17.013,18]octadeca-1(17),2,4,9,11,13(18)-hexaene-7,15-dicarboxylate (PubChem CID 100949582) has the molecular formula C32H40N2O8 and a molecular weight of 580.68 g/mol. Its IUPAC name is dimethyl 7,15-bis[(2-methylpropan-2-yl)oxycarbonylamino]tetracyclo[7.7.2.05,17.013,18]octadeca-1(17),2,4,9,11,13(18)-hexaene-7,15-dicarboxylate.
| Compound Name | dimethyl 7,15-bis[(2-methylpropan-2-yl)oxycarbonylamino]tetracyclo[7.7.2.05,17.013,18]octadeca-1(17),2,4,9,11,13(18)-hexaene-7,15-dicarboxylate |
|---|---|
| PubChem CID | 100949582 |
| Molecular Formula | C32H40N2O8 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | dimethyl 7,15-bis[(2-methylpropan-2-yl)oxycarbonylamino]tetracyclo[7.7.2.05,17.013,18]octadeca-1(17),2,4,9,11,13(18)-hexaene-7,15-dicarboxylate |
| SMILES | COC(=O)C1(NC(=O)OC(C)(C)C)Cc2cccc3c2-c2c(cccc2CC(NC(=O)OC(C)(C)C)(C(=O)OC)C3)C1 |
| InChI | InChI=1S/C32H40N2O8/c1-29(2,3)41-27(37)33-31(25(35)39-7)15-19-11-9-13-21-17-32(26(36)40-8,34-28(38)42-30(4,5)6)18-22-14-10-12-20(16-31)24(22)23(19)21/h9-14H,15-18H2,1-8H3,(H,33,37)(H,34,38) |
| InChIKey | XYDXYQCUZVNHEY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|