C12H21NO7S — CID 135349998
methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate (PubChem CID 135349998) has the molecular formula C12H21NO7S and a molecular weight of 323.37 g/mol. Its IUPAC name is methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate.
| Compound Name | methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 135349998 |
| Molecular Formula | C12H21NO7S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)OC(C)(C)C)CC(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H21NO7S/c1-11(2,3)19-10(15)13-12(9(14)18-4)6-8(7-12)20-21(5,16)17/h8H,6-7H2,1-5H3,(H,13,15) |
| InChIKey | KYZLSHMTPZPROJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|