C13H23NO7S — CID 134303828
ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate (PubChem CID 134303828) has the molecular formula C13H23NO7S and a molecular weight of 337.39 g/mol. Its IUPAC name is ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate.
| Compound Name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 134303828 |
| Molecular Formula | C13H23NO7S |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | ethyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]-3-methylsulfonyloxycyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)OC(C)(C)C)CC(OS(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H23NO7S/c1-6-19-10(15)13(14-11(16)20-12(2,3)4)7-9(8-13)21-22(5,17)18/h9H,6-8H2,1-5H3,(H,14,16) |
| InChIKey | QJTZGTZSLWFHPU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|