C20H36N2O6 — CID 22369528
diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pentylpyrrolidine-2,4-dicarboxylate (PubChem CID 22369528) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pentylpyrrolidine-2,4-dicarboxylate.
| Compound Name | diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pentylpyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 22369528 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | diethyl 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-pentylpyrrolidine-2,4-dicarboxylate |
| SMILES | CCCCCN1CC(NC(=O)OC(C)(C)C)(C(=O)OCC)CC1C(=O)OCC |
| InChI | InChI=1S/C20H36N2O6/c1-7-10-11-12-22-14-20(17(24)27-9-3,13-15(22)16(23)26-8-2)21-18(25)28-19(4,5)6/h15H,7-14H2,1-6H3,(H,21,25) |
| InChIKey | BGWCOONLLWKLBB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|