C12H21NO8S — CID 88870647
methyl (3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxyoxolane-3-carboxylate (PubChem CID 88870647) has the molecular formula C12H21NO8S and a molecular weight of 339.37 g/mol. Its IUPAC name is methyl (3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxyoxolane-3-carboxylate.
| Compound Name | methyl (3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxyoxolane-3-carboxylate |
|---|---|
| PubChem CID | 88870647 |
| Molecular Formula | C12H21NO8S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | methyl (3R,4R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxyoxolane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(NC(=O)OC(C)(C)C)COC[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C12H21NO8S/c1-11(2,3)20-10(15)13-12(9(14)18-4)7-19-6-8(12)21-22(5,16)17/h8H,6-7H2,1-5H3,(H,13,15)/t8-,12+/m0/s1 |
| InChIKey | HMZFOSNZGJYRGR-QPUJVOFHSA-N |
| XLogP | -0.20 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|