C10H15NO4 — CID 10584690
methyl 1-acetamido-4-oxocyclohexane-1-carboxylate (PubChem CID 10584690) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is methyl 1-acetamido-4-oxocyclohexane-1-carboxylate.
| Compound Name | methyl 1-acetamido-4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10584690 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | methyl 1-acetamido-4-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(NC(C)=O)CCC(=O)CC1 |
| InChI | InChI=1S/C10H15NO4/c1-7(12)11-10(9(14)15-2)5-3-8(13)4-6-10/h3-6H2,1-2H3,(H,11,12) |
| InChIKey | PDCIYFZIAMDNJR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |