C13H11Cl4NO3 — CID 102294862
methyl 2-acetamido-4,5,6,7-tetrachloro-1,3-dihydroindene-2-carboxylate (PubChem CID 102294862) has the molecular formula C13H11Cl4NO3 and a molecular weight of 371.05 g/mol. Its IUPAC name is methyl 2-acetamido-4,5,6,7-tetrachloro-1,3-dihydroindene-2-carboxylate.
| Compound Name | methyl 2-acetamido-4,5,6,7-tetrachloro-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 102294862 |
| Molecular Formula | C13H11Cl4NO3 |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | methyl 2-acetamido-4,5,6,7-tetrachloro-1,3-dihydroindene-2-carboxylate |
| SMILES | COC(=O)C1(NC(C)=O)Cc2c(Cl)c(Cl)c(Cl)c(Cl)c2C1 |
| InChI | InChI=1S/C13H11Cl4NO3/c1-5(19)18-13(12(20)21-2)3-6-7(4-13)9(15)11(17)10(16)8(6)14/h3-4H2,1-2H3,(H,18,19) |
| InChIKey | RCHUBJDQXIZVSX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|