C14H15Br2NO3 — CID 12986070
ethyl 2-acetamido-5,6-dibromo-1,3-dihydroindene-2-carboxylate (PubChem CID 12986070) has the molecular formula C14H15Br2NO3 and a molecular weight of 405.09 g/mol. Its IUPAC name is ethyl 2-acetamido-5,6-dibromo-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-acetamido-5,6-dibromo-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 12986070 |
| Molecular Formula | C14H15Br2NO3 |
| Molecular Weight | 405.09 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | ethyl 2-acetamido-5,6-dibromo-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(NC(C)=O)Cc2cc(Br)c(Br)cc2C1 |
| InChI | InChI=1S/C14H15Br2NO3/c1-3-20-13(19)14(17-8(2)18)6-9-4-11(15)12(16)5-10(9)7-14/h4-5H,3,6-7H2,1-2H3,(H,17,18) |
| InChIKey | BPNIRXVSRPLMJH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.09 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |