C20H21BrN2O3 — CID 59314116
ethyl 2-[(6-amino-2-bromo-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylate (PubChem CID 59314116) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is ethyl 2-[(6-amino-2-bromo-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-[(6-amino-2-bromo-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 59314116 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | ethyl 2-[(6-amino-2-bromo-3-methylbenzoyl)amino]-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)c2c(N)ccc(C)c2Br)Cc2ccccc2C1 |
| InChI | InChI=1S/C20H21BrN2O3/c1-3-26-19(25)20(10-13-6-4-5-7-14(13)11-20)23-18(24)16-15(22)9-8-12(2)17(16)21/h4-9H,3,10-11,22H2,1-2H3,(H,23,24) |
| InChIKey | CIQRSKXFPLRJCP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|