C15H16ClNO3 — CID 146095225
ethyl 5-chloro-2-(prop-2-enoylamino)-1,3-dihydroindene-2-carboxylate (PubChem CID 146095225) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is ethyl 5-chloro-2-(prop-2-enoylamino)-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 5-chloro-2-(prop-2-enoylamino)-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 146095225 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | ethyl 5-chloro-2-(prop-2-enoylamino)-1,3-dihydroindene-2-carboxylate |
| SMILES | C=CC(=O)NC1(C(=O)OCC)Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C15H16ClNO3/c1-3-13(18)17-15(14(19)20-4-2)8-10-5-6-12(16)7-11(10)9-15/h3,5-7H,1,4,8-9H2,2H3,(H,17,18) |
| InChIKey | GXDAEADKMOHTNZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|