C20H19BrClNO3 — CID 68666879
ethyl 2-[(2-bromoacetyl)amino]-5-(4-chlorophenyl)-1,3-dihydroindene-2-carboxylate (PubChem CID 68666879) has the molecular formula C20H19BrClNO3 and a molecular weight of 436.73 g/mol. Its IUPAC name is ethyl 2-[(2-bromoacetyl)amino]-5-(4-chlorophenyl)-1,3-dihydroindene-2-carboxylate.
| Compound Name | ethyl 2-[(2-bromoacetyl)amino]-5-(4-chlorophenyl)-1,3-dihydroindene-2-carboxylate |
|---|---|
| PubChem CID | 68666879 |
| Molecular Formula | C20H19BrClNO3 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 435.02 |
| IUPAC Name | ethyl 2-[(2-bromoacetyl)amino]-5-(4-chlorophenyl)-1,3-dihydroindene-2-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)CBr)Cc2ccc(-c3ccc(Cl)cc3)cc2C1 |
| InChI | InChI=1S/C20H19BrClNO3/c1-2-26-19(25)20(23-18(24)12-21)10-15-4-3-14(9-16(15)11-20)13-5-7-17(22)8-6-13/h3-9H,2,10-12H2,1H3,(H,23,24) |
| InChIKey | JAMMRDTXQOTYAU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|