About (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate
(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate (PubChem CID 85385549) has the molecular formula C12H20O3
and a molecular weight of 212.29 g/mol. Its IUPAC name is (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate.
Analyze (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate?
The IUPAC name of (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate (CID 85385549) is (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate.
What is the SMILES notation for (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate?
The canonical SMILES for (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate is CC(=O)OCC1(O)C2CCC(C2)C1(C)C.
What is the InChIKey of (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate?
The InChIKey is ROLMXLIARALJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3/c1-8(13)15-7-12(14)10-5-4-9(6-10)11(12,2)3/h9-10,14H,4-7H2,1-3H3.
What are the key properties of (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate?
(2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate has a molecular weight of 212.29 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3,3-dimethyl-2-bicyclo[2.2.1]heptanyl)methyl acetate is sourced from PubChem (CID 85385549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).