3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid

C12H20O4 — CID 70230096

IUPAC3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
SMILESCC(=O)OCC1(C)CCC(C(=O)O)C1(C)C
InChIInChI=1S/C12H20O4/c1-8(13)16-7-12(4)6-5-9(10(14)15)11(12,2)3/h9H,5-7H2,1-4H3,(H,14,15)
InChIKeyCMCUESDDRMALSK-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.08
Rot. Bonds3

About 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid

3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid (PubChem CID 70230096) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid.

Molecular Properties

Compound Name3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
PubChem CID70230096
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid
SMILESCC(=O)OCC1(C)CCC(C(=O)O)C1(C)C
InChIInChI=1S/C12H20O4/c1-8(13)16-7-12(4)6-5-9(10(14)15)11(12,2)3/h9H,5-7H2,1-4H3,(H,14,15)
InChIKeyCMCUESDDRMALSK-UHFFFAOYSA-N
XLogP2.08
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The IUPAC name of 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid (CID 70230096) is 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The canonical SMILES for 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid is CC(=O)OCC1(C)CCC(C(=O)O)C1(C)C.
What is the InChIKey of 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
The InChIKey is CMCUESDDRMALSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-8(13)16-7-12(4)6-5-9(10(14)15)11(12,2)3/h9H,5-7H2,1-4H3,(H,14,15).
What are the key properties of 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid?
3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid has a molecular weight of 228.29 g/mol, XLogP of 2.08, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(acetyloxymethyl)-2,2,3-trimethylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 70230096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).