C16H26O7 — CID 11002034
dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-(2-oxoethyl)cyclohexyl]propanedioate (PubChem CID 11002034) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-(2-oxoethyl)cyclohexyl]propanedioate.
| Compound Name | dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-(2-oxoethyl)cyclohexyl]propanedioate |
|---|---|
| PubChem CID | 11002034 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | dimethyl 2-[(1R,2R,3R)-3-(methoxymethoxy)-2-methyl-2-(2-oxoethyl)cyclohexyl]propanedioate |
| SMILES | COCO[C@@H]1CCC[C@H](C(C(=O)OC)C(=O)OC)[C@@]1(C)CC=O |
| InChI | InChI=1S/C16H26O7/c1-16(8-9-17)11(6-5-7-12(16)23-10-20-2)13(14(18)21-3)15(19)22-4/h9,11-13H,5-8,10H2,1-4H3/t11-,12-,16-/m1/s1 |
| InChIKey | HGBUULBHQBHCNK-XHBSWPGZSA-N |
| XLogP | 1.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|