C19H26O6 — CID 53343984
methyl (1R,7R,7aS)-7-(methoxymethoxy)-2-oxo-1-(3-oxopropyl)-7a-prop-2-enyl-4,5,6,7-tetrahydroindene-1-carboxylate (PubChem CID 53343984) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is methyl (1R,7R,7aS)-7-(methoxymethoxy)-2-oxo-1-(3-oxopropyl)-7a-prop-2-enyl-4,5,6,7-tetrahydroindene-1-carboxylate.
| Compound Name | methyl (1R,7R,7aS)-7-(methoxymethoxy)-2-oxo-1-(3-oxopropyl)-7a-prop-2-enyl-4,5,6,7-tetrahydroindene-1-carboxylate |
|---|---|
| PubChem CID | 53343984 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | methyl (1R,7R,7aS)-7-(methoxymethoxy)-2-oxo-1-(3-oxopropyl)-7a-prop-2-enyl-4,5,6,7-tetrahydroindene-1-carboxylate |
| SMILES | C=CC[C@]12C(=CC(=O)[C@]1(CCC=O)C(=O)OC)CCC[C@H]2OCOC |
| InChI | InChI=1S/C19H26O6/c1-4-9-18-14(7-5-8-16(18)25-13-23-2)12-15(21)19(18,10-6-11-20)17(22)24-3/h4,11-12,16H,1,5-10,13H2,2-3H3/t16-,18-,19-/m1/s1 |
| InChIKey | KWBNJHQAXZVRAX-BHIYHBOVSA-N |
| XLogP | 2.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|