C20H28O4 — CID 102445247
methyl (1R,4aS,4bR,10aR)-1,4a-dimethyl-7-oxo-4b-(2-oxoethyl)-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-carboxylate (PubChem CID 102445247) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl (1R,4aS,4bR,10aR)-1,4a-dimethyl-7-oxo-4b-(2-oxoethyl)-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,4bR,10aR)-1,4a-dimethyl-7-oxo-4b-(2-oxoethyl)-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 102445247 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl (1R,4aS,4bR,10aR)-1,4a-dimethyl-7-oxo-4b-(2-oxoethyl)-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@H]1CCC1=CC(=O)CC[C@@]12CC=O |
| InChI | InChI=1S/C20H28O4/c1-18(17(23)24-3)8-4-9-19(2)16(18)6-5-14-13-15(22)7-10-20(14,19)11-12-21/h12-13,16H,4-11H2,1-3H3/t16-,18+,19-,20+/m0/s1 |
| InChIKey | NHLYXHKCCWRQNO-OJAHFUOMSA-N |
| XLogP | 3.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|