C33H38O3 — CID 10885347
methyl (1R,4aS,10aR)-8-(3,3-diphenylprop-2-enyl)-1,4a-dimethyl-7-oxo-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 10885347) has the molecular formula C33H38O3 and a molecular weight of 482.66 g/mol. Its IUPAC name is methyl (1R,4aS,10aR)-8-(3,3-diphenylprop-2-enyl)-1,4a-dimethyl-7-oxo-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,10aR)-8-(3,3-diphenylprop-2-enyl)-1,4a-dimethyl-7-oxo-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 10885347 |
| Molecular Formula | C33H38O3 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | methyl (1R,4aS,10aR)-8-(3,3-diphenylprop-2-enyl)-1,4a-dimethyl-7-oxo-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)C3=C(CC[C@@H]12)C(CC=C(c1ccccc1)c1ccccc1)C(=O)CC3 |
| InChI | InChI=1S/C33H38O3/c1-32-21-10-22-33(2,31(35)36-3)30(32)20-17-26-27(29(34)19-18-28(26)32)16-15-25(23-11-6-4-7-12-23)24-13-8-5-9-14-24/h4-9,11-15,27,30H,10,16-22H2,1-3H3/t27?,30-,32-,33-/m1/s1 |
| InChIKey | DWEWKSABTOEMJE-LOFCQNMHSA-N |
| XLogP | 7.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|