C20H28O4 — CID 56776219
methyl (4S,5R,9R,13R)-5,9-dimethyl-10,14-dioxotricyclo[11.2.1.04,9]hexadec-1(15)-ene-5-carboxylate (PubChem CID 56776219) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is methyl (4S,5R,9R,13R)-5,9-dimethyl-10,14-dioxotricyclo[11.2.1.04,9]hexadec-1(15)-ene-5-carboxylate.
| Compound Name | methyl (4S,5R,9R,13R)-5,9-dimethyl-10,14-dioxotricyclo[11.2.1.04,9]hexadec-1(15)-ene-5-carboxylate |
|---|---|
| PubChem CID | 56776219 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | methyl (4S,5R,9R,13R)-5,9-dimethyl-10,14-dioxotricyclo[11.2.1.04,9]hexadec-1(15)-ene-5-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)C(=O)CC[C@@H]3CC(=CC3=O)CC[C@@H]21 |
| InChI | InChI=1S/C20H28O4/c1-19-9-4-10-20(2,18(23)24-3)16(19)7-5-13-11-14(15(21)12-13)6-8-17(19)22/h12,14,16H,4-11H2,1-3H3/t14-,16+,19-,20-/m1/s1 |
| InChIKey | ZAGGYKLVUQTZDW-HIBPSGHXSA-N |
| XLogP | 3.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |